C12H9Cl3O — CID 57350002
1,2,6-trichloro-4-phenylcyclohexa-2,4-dien-1-ol (PubChem CID 57350002) has the molecular formula C12H9Cl3O and a molecular weight of 275.56 g/mol. Its IUPAC name is 1,2,6-trichloro-4-phenylcyclohexa-2,4-dien-1-ol.
| Compound Name | 1,2,6-trichloro-4-phenylcyclohexa-2,4-dien-1-ol |
|---|---|
| PubChem CID | 57350002 |
| Molecular Formula | C12H9Cl3O |
| Molecular Weight | 275.56 g/mol |
| Exact Mass | 273.97 |
| IUPAC Name | 1,2,6-trichloro-4-phenylcyclohexa-2,4-dien-1-ol |
| SMILES | OC1(Cl)C(Cl)=CC(c2ccccc2)=CC1Cl |
| InChI | InChI=1S/C12H9Cl3O/c13-10-6-9(7-11(14)12(10,15)16)8-4-2-1-3-5-8/h1-7,10,16H |
| InChIKey | SDUBWJKCZFNORP-UHFFFAOYSA-N |
| XLogP | 3.74 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 275.56 |
| LogP ≤ 5 | 3.74 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|