About 2-(6-chloro-6-methyl-3-phenylcyclohexa-2,4-dien-1-yl)acetic acid
2-(6-chloro-6-methyl-3-phenylcyclohexa-2,4-dien-1-yl)acetic acid (PubChem CID 174698946) has the molecular formula C15H15ClO2
and a molecular weight of 262.74 g/mol. Its IUPAC name is 2-(6-chloro-6-methyl-3-phenylcyclohexa-2,4-dien-1-yl)acetic acid.
Molecular Properties
| Compound Name | 2-(6-chloro-6-methyl-3-phenylcyclohexa-2,4-dien-1-yl)acetic acid |
| PubChem CID | 174698946 |
| Molecular Formula | C15H15ClO2 |
| Molecular Weight | 262.74 g/mol |
| Exact Mass | 262.08 |
| IUPAC Name | 2-(6-chloro-6-methyl-3-phenylcyclohexa-2,4-dien-1-yl)acetic acid |
| SMILES | CC1(Cl)C=CC(c2ccccc2)=CC1CC(=O)O |
| InChI | InChI=1S/C15H15ClO2/c1-15(16)8-7-12(9-13(15)10-14(17)18)11-5-3-2-4-6-11/h2-9,13H,10H2,1H3,(H,17,18) |
| InChIKey | BBQIACISMLKVLV-UHFFFAOYSA-N |
| XLogP | 3.73 |
| TPSA | 37.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 262.74 |
| LogP ≤ 5 | 3.73 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|
Analyze 2-(6-chloro-6-methyl-3-phenylcyclohexa-2,4-dien-1-yl)acetic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-(6-chloro-6-methyl-3-phenylcyclohexa-2,4-dien-1-yl)acetic acid?
The IUPAC name of 2-(6-chloro-6-methyl-3-phenylcyclohexa-2,4-dien-1-yl)acetic acid (CID 174698946) is 2-(6-chloro-6-methyl-3-phenylcyclohexa-2,4-dien-1-yl)acetic acid.
What is the SMILES notation for 2-(6-chloro-6-methyl-3-phenylcyclohexa-2,4-dien-1-yl)acetic acid?
The canonical SMILES for 2-(6-chloro-6-methyl-3-phenylcyclohexa-2,4-dien-1-yl)acetic acid is CC1(Cl)C=CC(c2ccccc2)=CC1CC(=O)O.
What is the InChIKey of 2-(6-chloro-6-methyl-3-phenylcyclohexa-2,4-dien-1-yl)acetic acid?
The InChIKey is BBQIACISMLKVLV-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H15ClO2/c1-15(16)8-7-12(9-13(15)10-14(17)18)11-5-3-2-4-6-11/h2-9,13H,10H2,1H3,(H,17,18).
What are the key properties of 2-(6-chloro-6-methyl-3-phenylcyclohexa-2,4-dien-1-yl)acetic acid?
2-(6-chloro-6-methyl-3-phenylcyclohexa-2,4-dien-1-yl)acetic acid has a molecular weight of 262.74 g/mol, XLogP of 3.73, 3 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(6-chloro-6-methyl-3-phenylcyclohexa-2,4-dien-1-yl)acetic acid is sourced from PubChem (CID 174698946), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).