About 1,6-difluoro-6-methyl-4-phenylcyclohexa-2,4-diene-1-carboxylic acid
1,6-difluoro-6-methyl-4-phenylcyclohexa-2,4-diene-1-carboxylic acid (PubChem CID 170991641) has the molecular formula C14H12F2O2
and a molecular weight of 250.24 g/mol. Its IUPAC name is 1,6-difluoro-6-methyl-4-phenylcyclohexa-2,4-diene-1-carboxylic acid.
Molecular Properties
| Compound Name | 1,6-difluoro-6-methyl-4-phenylcyclohexa-2,4-diene-1-carboxylic acid |
| PubChem CID | 170991641 |
| Molecular Formula | C14H12F2O2 |
| Molecular Weight | 250.24 g/mol |
| Exact Mass | 250.08 |
| IUPAC Name | 1,6-difluoro-6-methyl-4-phenylcyclohexa-2,4-diene-1-carboxylic acid |
| SMILES | CC1(F)C=C(c2ccccc2)C=CC1(F)C(=O)O |
| InChI | InChI=1S/C14H12F2O2/c1-13(15)9-11(10-5-3-2-4-6-10)7-8-14(13,16)12(17)18/h2-9H,1H3,(H,17,18) |
| InChIKey | ASHRVGQXLAHDRO-UHFFFAOYSA-N |
| XLogP | 3.16 |
| TPSA | 37.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 250.24 |
| LogP ≤ 5 | 3.16 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze 1,6-difluoro-6-methyl-4-phenylcyclohexa-2,4-diene-1-carboxylic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1,6-difluoro-6-methyl-4-phenylcyclohexa-2,4-diene-1-carboxylic acid?
The IUPAC name of 1,6-difluoro-6-methyl-4-phenylcyclohexa-2,4-diene-1-carboxylic acid (CID 170991641) is 1,6-difluoro-6-methyl-4-phenylcyclohexa-2,4-diene-1-carboxylic acid.
What is the SMILES notation for 1,6-difluoro-6-methyl-4-phenylcyclohexa-2,4-diene-1-carboxylic acid?
The canonical SMILES for 1,6-difluoro-6-methyl-4-phenylcyclohexa-2,4-diene-1-carboxylic acid is CC1(F)C=C(c2ccccc2)C=CC1(F)C(=O)O.
What is the InChIKey of 1,6-difluoro-6-methyl-4-phenylcyclohexa-2,4-diene-1-carboxylic acid?
The InChIKey is ASHRVGQXLAHDRO-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H12F2O2/c1-13(15)9-11(10-5-3-2-4-6-10)7-8-14(13,16)12(17)18/h2-9H,1H3,(H,17,18).
What are the key properties of 1,6-difluoro-6-methyl-4-phenylcyclohexa-2,4-diene-1-carboxylic acid?
1,6-difluoro-6-methyl-4-phenylcyclohexa-2,4-diene-1-carboxylic acid has a molecular weight of 250.24 g/mol, XLogP of 3.16, 2 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 1,6-difluoro-6-methyl-4-phenylcyclohexa-2,4-diene-1-carboxylic acid is sourced from PubChem (CID 170991641), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).