C20H20O8 — CID 154191057
ethyl 2-[6-(2-ethoxy-2-oxoacetyl)-1,6-dihydroxy-4-phenylcyclohexa-2,4-dien-1-yl]-2-oxoacetate (PubChem CID 154191057) has the molecular formula C20H20O8 and a molecular weight of 388.37 g/mol. Its IUPAC name is ethyl 2-[6-(2-ethoxy-2-oxoacetyl)-1,6-dihydroxy-4-phenylcyclohexa-2,4-dien-1-yl]-2-oxoacetate.
| Compound Name | ethyl 2-[6-(2-ethoxy-2-oxoacetyl)-1,6-dihydroxy-4-phenylcyclohexa-2,4-dien-1-yl]-2-oxoacetate |
|---|---|
| PubChem CID | 154191057 |
| Molecular Formula | C20H20O8 |
| Molecular Weight | 388.37 g/mol |
| Exact Mass | 388.12 |
| IUPAC Name | ethyl 2-[6-(2-ethoxy-2-oxoacetyl)-1,6-dihydroxy-4-phenylcyclohexa-2,4-dien-1-yl]-2-oxoacetate |
| SMILES | CCOC(=O)C(=O)C1(O)C=CC(c2ccccc2)=CC1(O)C(=O)C(=O)OCC |
| InChI | InChI=1S/C20H20O8/c1-3-27-17(23)15(21)19(25)11-10-14(13-8-6-5-7-9-13)12-20(19,26)16(22)18(24)28-4-2/h5-12,25-26H,3-4H2,1-2H3 |
| InChIKey | CIXSRQYSCVJQBI-UHFFFAOYSA-N |
| XLogP | 0.37 |
| TPSA | 127.20 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 388.37 |
| LogP ≤ 5 | 0.37 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|