C28H25N3O5 — CID 14812293
ethyl 5-(2-ethoxy-2-oxoacetyl)-2,4,6-triphenyltriazine-5-carboxylate (PubChem CID 14812293) has the molecular formula C28H25N3O5 and a molecular weight of 483.52 g/mol. Its IUPAC name is ethyl 5-(2-ethoxy-2-oxoacetyl)-2,4,6-triphenyltriazine-5-carboxylate.
| Compound Name | ethyl 5-(2-ethoxy-2-oxoacetyl)-2,4,6-triphenyltriazine-5-carboxylate |
|---|---|
| PubChem CID | 14812293 |
| Molecular Formula | C28H25N3O5 |
| Molecular Weight | 483.52 g/mol |
| Exact Mass | 483.18 |
| IUPAC Name | ethyl 5-(2-ethoxy-2-oxoacetyl)-2,4,6-triphenyltriazine-5-carboxylate |
| SMILES | CCOC(=O)C(=O)C1(C(=O)OCC)C(c2ccccc2)=NN(c2ccccc2)N=C1c1ccccc1 |
| InChI | InChI=1S/C28H25N3O5/c1-3-35-26(33)25(32)28(27(34)36-4-2)23(20-14-8-5-9-15-20)29-31(22-18-12-7-13-19-22)30-24(28)21-16-10-6-11-17-21/h5-19H,3-4H2,1-2H3 |
| InChIKey | KLNNDWANGSRVCA-UHFFFAOYSA-N |
| XLogP | 4.00 |
| TPSA | 97.63 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 36 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 483.52 |
| LogP ≤ 5 | 4.00 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|