C18H15FN4O2 — CID 134094907
ethyl (Z)-3-(4-fluorophenyl)-2-(5-phenyltetrazol-1-yl)prop-2-enoate (PubChem CID 134094907) has the molecular formula C18H15FN4O2 and a molecular weight of 338.34 g/mol. Its IUPAC name is ethyl (Z)-3-(4-fluorophenyl)-2-(5-phenyltetrazol-1-yl)prop-2-enoate.
| Compound Name | ethyl (Z)-3-(4-fluorophenyl)-2-(5-phenyltetrazol-1-yl)prop-2-enoate |
|---|---|
| PubChem CID | 134094907 |
| Molecular Formula | C18H15FN4O2 |
| Molecular Weight | 338.34 g/mol |
| Exact Mass | 338.12 |
| IUPAC Name | ethyl (Z)-3-(4-fluorophenyl)-2-(5-phenyltetrazol-1-yl)prop-2-enoate |
| SMILES | CCOC(=O)/C(=C/c1ccc(F)cc1)n1nnnc1-c1ccccc1 |
| InChI | InChI=1S/C18H15FN4O2/c1-2-25-18(24)16(12-13-8-10-15(19)11-9-13)23-17(20-21-22-23)14-6-4-3-5-7-14/h3-12H,2H2,1H3/b16-12- |
| InChIKey | SEWFNEYJZRGEKJ-VBKFSLOCSA-N |
| XLogP | 3.04 |
| TPSA | 69.90 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 338.34 |
| LogP ≤ 5 | 3.04 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|