C26H25N5O4 — CID 41215201
[2-[benzyl(propan-2-yl)amino]-2-oxoethyl] (Z)-3-(furan-2-yl)-2-(5-phenyltetrazol-1-yl)prop-2-enoate (PubChem CID 41215201) has the molecular formula C26H25N5O4 and a molecular weight of 471.52 g/mol. Its IUPAC name is [2-[benzyl(propan-2-yl)amino]-2-oxoethyl] (Z)-3-(furan-2-yl)-2-(5-phenyltetrazol-1-yl)prop-2-enoate.
| Compound Name | [2-[benzyl(propan-2-yl)amino]-2-oxoethyl] (Z)-3-(furan-2-yl)-2-(5-phenyltetrazol-1-yl)prop-2-enoate |
|---|---|
| PubChem CID | 41215201 |
| Molecular Formula | C26H25N5O4 |
| Molecular Weight | 471.52 g/mol |
| Exact Mass | 471.19 |
| IUPAC Name | [2-[benzyl(propan-2-yl)amino]-2-oxoethyl] (Z)-3-(furan-2-yl)-2-(5-phenyltetrazol-1-yl)prop-2-enoate |
| SMILES | CC(C)N(Cc1ccccc1)C(=O)COC(=O)/C(=C/c1ccco1)n1nnnc1-c1ccccc1 |
| InChI | InChI=1S/C26H25N5O4/c1-19(2)30(17-20-10-5-3-6-11-20)24(32)18-35-26(33)23(16-22-14-9-15-34-22)31-25(27-28-29-31)21-12-7-4-8-13-21/h3-16,19H,17-18H2,1-2H3/b23-16- |
| InChIKey | JNTUROSWNBAKCM-KQWNVCNZSA-N |
| XLogP | 3.91 |
| TPSA | 103.35 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 471.52 |
| LogP ≤ 5 | 3.91 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|