C23H15F3N4O4 — CID 41215853
[2-oxo-2-[3-(trifluoromethyl)phenyl]ethyl] (Z)-3-(furan-2-yl)-2-(5-phenyltetrazol-1-yl)prop-2-enoate (PubChem CID 41215853) has the molecular formula C23H15F3N4O4 and a molecular weight of 468.39 g/mol. Its IUPAC name is [2-oxo-2-[3-(trifluoromethyl)phenyl]ethyl] (Z)-3-(furan-2-yl)-2-(5-phenyltetrazol-1-yl)prop-2-enoate.
| Compound Name | [2-oxo-2-[3-(trifluoromethyl)phenyl]ethyl] (Z)-3-(furan-2-yl)-2-(5-phenyltetrazol-1-yl)prop-2-enoate |
|---|---|
| PubChem CID | 41215853 |
| Molecular Formula | C23H15F3N4O4 |
| Molecular Weight | 468.39 g/mol |
| Exact Mass | 468.10 |
| IUPAC Name | [2-oxo-2-[3-(trifluoromethyl)phenyl]ethyl] (Z)-3-(furan-2-yl)-2-(5-phenyltetrazol-1-yl)prop-2-enoate |
| SMILES | O=C(OCC(=O)c1cccc(C(F)(F)F)c1)/C(=C/c1ccco1)n1nnnc1-c1ccccc1 |
| InChI | InChI=1S/C23H15F3N4O4/c24-23(25,26)17-9-4-8-16(12-17)20(31)14-34-22(32)19(13-18-10-5-11-33-18)30-21(27-28-29-30)15-6-2-1-3-7-15/h1-13H,14H2/b19-13- |
| InChIKey | RIVHXQITZHELDL-UYRXBGFRSA-N |
| XLogP | 4.38 |
| TPSA | 100.11 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 468.39 |
| LogP ≤ 5 | 4.38 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|