C19H18F3N5O2 — CID 134061444
(E)-N-ethyl-3-(furan-2-yl)-2-(5-phenyltetrazol-1-yl)-N-(3,3,3-trifluoropropyl)prop-2-enamide (PubChem CID 134061444) has the molecular formula C19H18F3N5O2 and a molecular weight of 405.38 g/mol. Its IUPAC name is (E)-N-ethyl-3-(furan-2-yl)-2-(5-phenyltetrazol-1-yl)-N-(3,3,3-trifluoropropyl)prop-2-enamide.
| Compound Name | (E)-N-ethyl-3-(furan-2-yl)-2-(5-phenyltetrazol-1-yl)-N-(3,3,3-trifluoropropyl)prop-2-enamide |
|---|---|
| PubChem CID | 134061444 |
| Molecular Formula | C19H18F3N5O2 |
| Molecular Weight | 405.38 g/mol |
| Exact Mass | 405.14 |
| IUPAC Name | (E)-N-ethyl-3-(furan-2-yl)-2-(5-phenyltetrazol-1-yl)-N-(3,3,3-trifluoropropyl)prop-2-enamide |
| SMILES | CCN(CCC(F)(F)F)C(=O)/C(=C\c1ccco1)n1nnnc1-c1ccccc1 |
| InChI | InChI=1S/C19H18F3N5O2/c1-2-26(11-10-19(20,21)22)18(28)16(13-15-9-6-12-29-15)27-17(23-24-25-27)14-7-4-3-5-8-14/h3-9,12-13H,2,10-11H2,1H3/b16-13+ |
| InChIKey | MZKRCOHUXHXNQP-DTQAZKPQSA-N |
| XLogP | 3.73 |
| TPSA | 77.05 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 405.38 |
| LogP ≤ 5 | 3.73 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|