C16H13N5O4 — CID 7769582
(2-amino-2-oxoethyl) (Z)-3-(furan-2-yl)-2-(5-phenyltetrazol-1-yl)prop-2-enoate (PubChem CID 7769582) has the molecular formula C16H13N5O4 and a molecular weight of 339.31 g/mol. Its IUPAC name is (2-amino-2-oxoethyl) (Z)-3-(furan-2-yl)-2-(5-phenyltetrazol-1-yl)prop-2-enoate.
| Compound Name | (2-amino-2-oxoethyl) (Z)-3-(furan-2-yl)-2-(5-phenyltetrazol-1-yl)prop-2-enoate |
|---|---|
| PubChem CID | 7769582 |
| Molecular Formula | C16H13N5O4 |
| Molecular Weight | 339.31 g/mol |
| Exact Mass | 339.10 |
| IUPAC Name | (2-amino-2-oxoethyl) (Z)-3-(furan-2-yl)-2-(5-phenyltetrazol-1-yl)prop-2-enoate |
| SMILES | NC(=O)COC(=O)/C(=C/c1ccco1)n1nnnc1-c1ccccc1 |
| InChI | InChI=1S/C16H13N5O4/c17-14(22)10-25-16(23)13(9-12-7-4-8-24-12)21-15(18-19-20-21)11-5-2-1-3-6-11/h1-9H,10H2,(H2,17,22)/b13-9- |
| InChIKey | AFNBETPZJYRTBI-LCYFTJDESA-N |
| XLogP | 0.96 |
| TPSA | 126.13 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 339.31 |
| LogP ≤ 5 | 0.96 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|