C25H19N5O5 — CID 24577262
[3-(4-methoxyphenyl)-1,2-oxazol-5-yl]methyl (Z)-3-(furan-2-yl)-2-(5-phenyltetrazol-1-yl)prop-2-enoate (PubChem CID 24577262) has the molecular formula C25H19N5O5 and a molecular weight of 469.46 g/mol. Its IUPAC name is [3-(4-methoxyphenyl)-1,2-oxazol-5-yl]methyl (Z)-3-(furan-2-yl)-2-(5-phenyltetrazol-1-yl)prop-2-enoate.
| Compound Name | [3-(4-methoxyphenyl)-1,2-oxazol-5-yl]methyl (Z)-3-(furan-2-yl)-2-(5-phenyltetrazol-1-yl)prop-2-enoate |
|---|---|
| PubChem CID | 24577262 |
| Molecular Formula | C25H19N5O5 |
| Molecular Weight | 469.46 g/mol |
| Exact Mass | 469.14 |
| IUPAC Name | [3-(4-methoxyphenyl)-1,2-oxazol-5-yl]methyl (Z)-3-(furan-2-yl)-2-(5-phenyltetrazol-1-yl)prop-2-enoate |
| SMILES | COc1ccc(-c2cc(COC(=O)/C(=C/c3ccco3)n3nnnc3-c3ccccc3)on2)cc1 |
| InChI | InChI=1S/C25H19N5O5/c1-32-19-11-9-17(10-12-19)22-14-21(35-27-22)16-34-25(31)23(15-20-8-5-13-33-20)30-24(26-28-29-30)18-6-3-2-4-7-18/h2-15H,16H2,1H3/b23-15- |
| InChIKey | XZPAPMRUPFFHBR-HAHDFKILSA-N |
| XLogP | 4.34 |
| TPSA | 118.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 469.46 |
| LogP ≤ 5 | 4.34 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|