C22H19N5O4 — CID 18227034
(Z)-N-(3,5-dimethoxyphenyl)-3-(furan-2-yl)-2-(5-phenyltetrazol-1-yl)prop-2-enamide (PubChem CID 18227034) has the molecular formula C22H19N5O4 and a molecular weight of 417.43 g/mol. Its IUPAC name is (Z)-N-(3,5-dimethoxyphenyl)-3-(furan-2-yl)-2-(5-phenyltetrazol-1-yl)prop-2-enamide.
| Compound Name | (Z)-N-(3,5-dimethoxyphenyl)-3-(furan-2-yl)-2-(5-phenyltetrazol-1-yl)prop-2-enamide |
|---|---|
| PubChem CID | 18227034 |
| Molecular Formula | C22H19N5O4 |
| Molecular Weight | 417.43 g/mol |
| Exact Mass | 417.14 |
| IUPAC Name | (Z)-N-(3,5-dimethoxyphenyl)-3-(furan-2-yl)-2-(5-phenyltetrazol-1-yl)prop-2-enamide |
| SMILES | COc1cc(NC(=O)/C(=C/c2ccco2)n2nnnc2-c2ccccc2)cc(OC)c1 |
| InChI | InChI=1S/C22H19N5O4/c1-29-18-11-16(12-19(13-18)30-2)23-22(28)20(14-17-9-6-10-31-17)27-21(24-25-26-27)15-7-4-3-5-8-15/h3-14H,1-2H3,(H,23,28)/b20-14- |
| InChIKey | HBBNNGZRLFDJDA-ZHZULCJRSA-N |
| XLogP | 3.59 |
| TPSA | 104.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 417.43 |
| LogP ≤ 5 | 3.59 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|