C24H18N6O2 — CID 72685071
3-(furan-2-yl)-N-(2-methylquinolin-8-yl)-2-(5-phenyltetrazol-1-yl)prop-2-enamide (PubChem CID 72685071) has the molecular formula C24H18N6O2 and a molecular weight of 422.45 g/mol. Its IUPAC name is 3-(furan-2-yl)-N-(2-methylquinolin-8-yl)-2-(5-phenyltetrazol-1-yl)prop-2-enamide.
| Compound Name | 3-(furan-2-yl)-N-(2-methylquinolin-8-yl)-2-(5-phenyltetrazol-1-yl)prop-2-enamide |
|---|---|
| PubChem CID | 72685071 |
| Molecular Formula | C24H18N6O2 |
| Molecular Weight | 422.45 g/mol |
| Exact Mass | 422.15 |
| IUPAC Name | 3-(furan-2-yl)-N-(2-methylquinolin-8-yl)-2-(5-phenyltetrazol-1-yl)prop-2-enamide |
| SMILES | Cc1ccc2cccc(NC(=O)C(=Cc3ccco3)n3nnnc3-c3ccccc3)c2n1 |
| InChI | InChI=1S/C24H18N6O2/c1-16-12-13-17-9-5-11-20(22(17)25-16)26-24(31)21(15-19-10-6-14-32-19)30-23(27-28-29-30)18-7-3-2-4-8-18/h2-15H,1H3,(H,26,31) |
| InChIKey | RQFBTZMYENFZCW-UHFFFAOYSA-N |
| XLogP | 4.43 |
| TPSA | 98.73 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 422.45 |
| LogP ≤ 5 | 4.43 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|