C21H14N6O2S2 — CID 55360248
(Z)-3-(furan-2-yl)-2-(5-phenyltetrazol-1-yl)-N-(4-thiophen-2-yl-1,3-thiazol-2-yl)prop-2-enamide (PubChem CID 55360248) has the molecular formula C21H14N6O2S2 and a molecular weight of 446.52 g/mol. Its IUPAC name is (Z)-3-(furan-2-yl)-2-(5-phenyltetrazol-1-yl)-N-(4-thiophen-2-yl-1,3-thiazol-2-yl)prop-2-enamide.
| Compound Name | (Z)-3-(furan-2-yl)-2-(5-phenyltetrazol-1-yl)-N-(4-thiophen-2-yl-1,3-thiazol-2-yl)prop-2-enamide |
|---|---|
| PubChem CID | 55360248 |
| Molecular Formula | C21H14N6O2S2 |
| Molecular Weight | 446.52 g/mol |
| Exact Mass | 446.06 |
| IUPAC Name | (Z)-3-(furan-2-yl)-2-(5-phenyltetrazol-1-yl)-N-(4-thiophen-2-yl-1,3-thiazol-2-yl)prop-2-enamide |
| SMILES | O=C(Nc1nc(-c2cccs2)cs1)/C(=C/c1ccco1)n1nnnc1-c1ccccc1 |
| InChI | InChI=1S/C21H14N6O2S2/c28-20(23-21-22-16(13-31-21)18-9-5-11-30-18)17(12-15-8-4-10-29-15)27-19(24-25-26-27)14-6-2-1-3-7-14/h1-13H,(H,22,23,28)/b17-12- |
| InChIKey | HXFJSYHHQLRICS-ATVHPVEESA-N |
| XLogP | 4.75 |
| TPSA | 98.73 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 446.52 |
| LogP ≤ 5 | 4.75 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|