C22H19N5O2S — CID 7962571
(Z)-N-(2-methoxy-5-methylphenyl)-2-(5-phenyltetrazol-1-yl)-3-thiophen-2-ylprop-2-enamide (PubChem CID 7962571) has the molecular formula C22H19N5O2S and a molecular weight of 417.49 g/mol. Its IUPAC name is (Z)-N-(2-methoxy-5-methylphenyl)-2-(5-phenyltetrazol-1-yl)-3-thiophen-2-ylprop-2-enamide.
| Compound Name | (Z)-N-(2-methoxy-5-methylphenyl)-2-(5-phenyltetrazol-1-yl)-3-thiophen-2-ylprop-2-enamide |
|---|---|
| PubChem CID | 7962571 |
| Molecular Formula | C22H19N5O2S |
| Molecular Weight | 417.49 g/mol |
| Exact Mass | 417.13 |
| IUPAC Name | (Z)-N-(2-methoxy-5-methylphenyl)-2-(5-phenyltetrazol-1-yl)-3-thiophen-2-ylprop-2-enamide |
| SMILES | COc1ccc(C)cc1NC(=O)/C(=C/c1cccs1)n1nnnc1-c1ccccc1 |
| InChI | InChI=1S/C22H19N5O2S/c1-15-10-11-20(29-2)18(13-15)23-22(28)19(14-17-9-6-12-30-17)27-21(24-25-26-27)16-7-4-3-5-8-16/h3-14H,1-2H3,(H,23,28)/b19-14- |
| InChIKey | PVLPTJTXUKZLAX-RGEXLXHISA-N |
| XLogP | 4.36 |
| TPSA | 81.93 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 417.49 |
| LogP ≤ 5 | 4.36 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|