C28H28N4O3S — CID 4845890
(4-octanoylphenyl) 2-(5-phenyltetrazol-1-yl)-3-thiophen-2-ylprop-2-enoate (PubChem CID 4845890) has the molecular formula C28H28N4O3S and a molecular weight of 500.62 g/mol. Its IUPAC name is (4-octanoylphenyl) 2-(5-phenyltetrazol-1-yl)-3-thiophen-2-ylprop-2-enoate.
| Compound Name | (4-octanoylphenyl) 2-(5-phenyltetrazol-1-yl)-3-thiophen-2-ylprop-2-enoate |
|---|---|
| PubChem CID | 4845890 |
| Molecular Formula | C28H28N4O3S |
| Molecular Weight | 500.62 g/mol |
| Exact Mass | 500.19 |
| IUPAC Name | (4-octanoylphenyl) 2-(5-phenyltetrazol-1-yl)-3-thiophen-2-ylprop-2-enoate |
| SMILES | CCCCCCCC(=O)c1ccc(OC(=O)C(=Cc2cccs2)n2nnnc2-c2ccccc2)cc1 |
| InChI | InChI=1S/C28H28N4O3S/c1-2-3-4-5-9-14-26(33)21-15-17-23(18-16-21)35-28(34)25(20-24-13-10-19-36-24)32-27(29-30-31-32)22-11-7-6-8-12-22/h6-8,10-13,15-20H,2-5,9,14H2,1H3 |
| InChIKey | WPLAFQWOCLSICJ-UHFFFAOYSA-N |
| XLogP | 6.55 |
| TPSA | 86.97 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 500.62 |
| LogP ≤ 5 | 6.55 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|