About quinolin-8-ylmethyl (Z)-2-(5-phenyltetrazol-1-yl)-3-thiophen-2-ylprop-2-enoate
quinolin-8-ylmethyl (Z)-2-(5-phenyltetrazol-1-yl)-3-thiophen-2-ylprop-2-enoate (PubChem CID 24577316) has the molecular formula C24H17N5O2S
and a molecular weight of 439.50 g/mol. Its IUPAC name is quinolin-8-ylmethyl (Z)-2-(5-phenyltetrazol-1-yl)-3-thiophen-2-ylprop-2-enoate.
Molecular Properties
| Compound Name | quinolin-8-ylmethyl (Z)-2-(5-phenyltetrazol-1-yl)-3-thiophen-2-ylprop-2-enoate |
| PubChem CID | 24577316 |
| Molecular Formula | C24H17N5O2S |
| Molecular Weight | 439.50 g/mol |
| Exact Mass | 439.11 |
| IUPAC Name | quinolin-8-ylmethyl (Z)-2-(5-phenyltetrazol-1-yl)-3-thiophen-2-ylprop-2-enoate |
| SMILES | O=C(OCc1cccc2cccnc12)/C(=C/c1cccs1)n1nnnc1-c1ccccc1 |
| InChI | InChI=1S/C24H17N5O2S/c30-24(31-16-19-10-4-9-17-11-5-13-25-22(17)19)21(15-20-12-6-14-32-20)29-23(26-27-28-29)18-7-2-1-3-8-18/h1-15H,16H2/b21-15- |
| InChIKey | JFGMVNLQQXFLOT-QNGOZBTKSA-N |
| XLogP | 4.69 |
| TPSA | 82.79 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 439.50 |
| LogP ≤ 5 | 4.69 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|
Analyze quinolin-8-ylmethyl (Z)-2-(5-phenyltetrazol-1-yl)-3-thiophen-2-ylprop-2-enoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of quinolin-8-ylmethyl (Z)-2-(5-phenyltetrazol-1-yl)-3-thiophen-2-ylprop-2-enoate?
The IUPAC name of quinolin-8-ylmethyl (Z)-2-(5-phenyltetrazol-1-yl)-3-thiophen-2-ylprop-2-enoate (CID 24577316) is quinolin-8-ylmethyl (Z)-2-(5-phenyltetrazol-1-yl)-3-thiophen-2-ylprop-2-enoate.
What is the SMILES notation for quinolin-8-ylmethyl (Z)-2-(5-phenyltetrazol-1-yl)-3-thiophen-2-ylprop-2-enoate?
The canonical SMILES for quinolin-8-ylmethyl (Z)-2-(5-phenyltetrazol-1-yl)-3-thiophen-2-ylprop-2-enoate is O=C(OCc1cccc2cccnc12)/C(=C/c1cccs1)n1nnnc1-c1ccccc1.
What is the InChIKey of quinolin-8-ylmethyl (Z)-2-(5-phenyltetrazol-1-yl)-3-thiophen-2-ylprop-2-enoate?
The InChIKey is JFGMVNLQQXFLOT-QNGOZBTKSA-N. The full InChI is InChI=1S/C24H17N5O2S/c30-24(31-16-19-10-4-9-17-11-5-13-25-22(17)19)21(15-20-12-6-14-32-20)29-23(26-27-28-29)18-7-2-1-3-8-18/h1-15H,16H2/b21-15-.
What are the key properties of quinolin-8-ylmethyl (Z)-2-(5-phenyltetrazol-1-yl)-3-thiophen-2-ylprop-2-enoate?
quinolin-8-ylmethyl (Z)-2-(5-phenyltetrazol-1-yl)-3-thiophen-2-ylprop-2-enoate has a molecular weight of 439.50 g/mol, XLogP of 4.69, 6 rotatable bonds, 0 hydrogen bond donors, and 8 hydrogen bond acceptors.
Where does this data come from?
All data for quinolin-8-ylmethyl (Z)-2-(5-phenyltetrazol-1-yl)-3-thiophen-2-ylprop-2-enoate is sourced from PubChem (CID 24577316), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).