C19H18N4O4S — CID 35446157
(2-oxo-2-propan-2-yloxyethyl) (Z)-2-(5-phenyltetrazol-1-yl)-3-thiophen-2-ylprop-2-enoate (PubChem CID 35446157) has the molecular formula C19H18N4O4S and a molecular weight of 398.44 g/mol. Its IUPAC name is (2-oxo-2-propan-2-yloxyethyl) (Z)-2-(5-phenyltetrazol-1-yl)-3-thiophen-2-ylprop-2-enoate.
| Compound Name | (2-oxo-2-propan-2-yloxyethyl) (Z)-2-(5-phenyltetrazol-1-yl)-3-thiophen-2-ylprop-2-enoate |
|---|---|
| PubChem CID | 35446157 |
| Molecular Formula | C19H18N4O4S |
| Molecular Weight | 398.44 g/mol |
| Exact Mass | 398.10 |
| IUPAC Name | (2-oxo-2-propan-2-yloxyethyl) (Z)-2-(5-phenyltetrazol-1-yl)-3-thiophen-2-ylprop-2-enoate |
| SMILES | CC(C)OC(=O)COC(=O)/C(=C/c1cccs1)n1nnnc1-c1ccccc1 |
| InChI | InChI=1S/C19H18N4O4S/c1-13(2)27-17(24)12-26-19(25)16(11-15-9-6-10-28-15)23-18(20-21-22-23)14-7-4-3-5-8-14/h3-11,13H,12H2,1-2H3/b16-11- |
| InChIKey | UIYGSBJDLZHTID-WJDWOHSUSA-N |
| XLogP | 2.89 |
| TPSA | 96.20 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 398.44 |
| LogP ≤ 5 | 2.89 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|