C20H21N5O4 — CID 134037138
propan-2-yl 3-[[(E)-3-(furan-2-yl)-2-(5-phenyltetrazol-1-yl)prop-2-enoyl]amino]propanoate (PubChem CID 134037138) has the molecular formula C20H21N5O4 and a molecular weight of 395.42 g/mol. Its IUPAC name is propan-2-yl 3-[[(E)-3-(furan-2-yl)-2-(5-phenyltetrazol-1-yl)prop-2-enoyl]amino]propanoate.
| Compound Name | propan-2-yl 3-[[(E)-3-(furan-2-yl)-2-(5-phenyltetrazol-1-yl)prop-2-enoyl]amino]propanoate |
|---|---|
| PubChem CID | 134037138 |
| Molecular Formula | C20H21N5O4 |
| Molecular Weight | 395.42 g/mol |
| Exact Mass | 395.16 |
| IUPAC Name | propan-2-yl 3-[[(E)-3-(furan-2-yl)-2-(5-phenyltetrazol-1-yl)prop-2-enoyl]amino]propanoate |
| SMILES | CC(C)OC(=O)CCNC(=O)/C(=C\c1ccco1)n1nnnc1-c1ccccc1 |
| InChI | InChI=1S/C20H21N5O4/c1-14(2)29-18(26)10-11-21-20(27)17(13-16-9-6-12-28-16)25-19(22-23-24-25)15-7-4-3-5-8-15/h3-9,12-14H,10-11H2,1-2H3,(H,21,27)/b17-13+ |
| InChIKey | VDMFMECDYLVPMC-GHRIWEEISA-N |
| XLogP | 2.39 |
| TPSA | 112.14 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 395.42 |
| LogP ≤ 5 | 2.39 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|