C21H16BrN5O2 — CID 24661294
(Z)-N-(4-bromo-3-methylphenyl)-3-(furan-2-yl)-2-(5-phenyltetrazol-1-yl)prop-2-enamide (PubChem CID 24661294) has the molecular formula C21H16BrN5O2 and a molecular weight of 450.30 g/mol. Its IUPAC name is (Z)-N-(4-bromo-3-methylphenyl)-3-(furan-2-yl)-2-(5-phenyltetrazol-1-yl)prop-2-enamide.
| Compound Name | (Z)-N-(4-bromo-3-methylphenyl)-3-(furan-2-yl)-2-(5-phenyltetrazol-1-yl)prop-2-enamide |
|---|---|
| PubChem CID | 24661294 |
| Molecular Formula | C21H16BrN5O2 |
| Molecular Weight | 450.30 g/mol |
| Exact Mass | 449.05 |
| IUPAC Name | (Z)-N-(4-bromo-3-methylphenyl)-3-(furan-2-yl)-2-(5-phenyltetrazol-1-yl)prop-2-enamide |
| SMILES | Cc1cc(NC(=O)/C(=C/c2ccco2)n2nnnc2-c2ccccc2)ccc1Br |
| InChI | InChI=1S/C21H16BrN5O2/c1-14-12-16(9-10-18(14)22)23-21(28)19(13-17-8-5-11-29-17)27-20(24-25-26-27)15-6-3-2-4-7-15/h2-13H,1H3,(H,23,28)/b19-13- |
| InChIKey | WJTDIWNSVNKOHZ-UYRXBGFRSA-N |
| XLogP | 4.64 |
| TPSA | 85.84 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 450.30 |
| LogP ≤ 5 | 4.64 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|