C27H26N6O4 — CID 55310805
[2-oxo-2-(4-piperidin-1-ylanilino)ethyl] (Z)-3-(furan-2-yl)-2-(5-phenyltetrazol-1-yl)prop-2-enoate (PubChem CID 55310805) has the molecular formula C27H26N6O4 and a molecular weight of 498.54 g/mol. Its IUPAC name is [2-oxo-2-(4-piperidin-1-ylanilino)ethyl] (Z)-3-(furan-2-yl)-2-(5-phenyltetrazol-1-yl)prop-2-enoate.
| Compound Name | [2-oxo-2-(4-piperidin-1-ylanilino)ethyl] (Z)-3-(furan-2-yl)-2-(5-phenyltetrazol-1-yl)prop-2-enoate |
|---|---|
| PubChem CID | 55310805 |
| Molecular Formula | C27H26N6O4 |
| Molecular Weight | 498.54 g/mol |
| Exact Mass | 498.20 |
| IUPAC Name | [2-oxo-2-(4-piperidin-1-ylanilino)ethyl] (Z)-3-(furan-2-yl)-2-(5-phenyltetrazol-1-yl)prop-2-enoate |
| SMILES | O=C(COC(=O)/C(=C/c1ccco1)n1nnnc1-c1ccccc1)Nc1ccc(N2CCCCC2)cc1 |
| InChI | InChI=1S/C27H26N6O4/c34-25(28-21-11-13-22(14-12-21)32-15-5-2-6-16-32)19-37-27(35)24(18-23-10-7-17-36-23)33-26(29-30-31-33)20-8-3-1-4-9-20/h1,3-4,7-14,17-18H,2,5-6,15-16,19H2,(H,28,34)/b24-18- |
| InChIKey | CYZLZCXISXDRRB-MOHJPFBDSA-N |
| XLogP | 4.10 |
| TPSA | 115.38 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 37 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 498.54 |
| LogP ≤ 5 | 4.10 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|