C22H16N6O3 — CID 7250549
imidazo[1,2-a]pyridin-2-ylmethyl (Z)-3-(furan-2-yl)-2-(5-phenyltetrazol-1-yl)prop-2-enoate (PubChem CID 7250549) has the molecular formula C22H16N6O3 and a molecular weight of 412.41 g/mol. Its IUPAC name is imidazo[1,2-a]pyridin-2-ylmethyl (Z)-3-(furan-2-yl)-2-(5-phenyltetrazol-1-yl)prop-2-enoate.
| Compound Name | imidazo[1,2-a]pyridin-2-ylmethyl (Z)-3-(furan-2-yl)-2-(5-phenyltetrazol-1-yl)prop-2-enoate |
|---|---|
| PubChem CID | 7250549 |
| Molecular Formula | C22H16N6O3 |
| Molecular Weight | 412.41 g/mol |
| Exact Mass | 412.13 |
| IUPAC Name | imidazo[1,2-a]pyridin-2-ylmethyl (Z)-3-(furan-2-yl)-2-(5-phenyltetrazol-1-yl)prop-2-enoate |
| SMILES | O=C(OCc1cn2ccccc2n1)/C(=C/c1ccco1)n1nnnc1-c1ccccc1 |
| InChI | InChI=1S/C22H16N6O3/c29-22(31-15-17-14-27-11-5-4-10-20(27)23-17)19(13-18-9-6-12-30-18)28-21(24-25-26-28)16-7-2-1-3-8-16/h1-14H,15H2/b19-13- |
| InChIKey | DWMIXDXNRLKTLA-UYRXBGFRSA-N |
| XLogP | 3.32 |
| TPSA | 100.34 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 412.41 |
| LogP ≤ 5 | 3.32 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|