C20H20N4O3S — CID 7810240
(3,3-dimethyl-2-oxobutyl) (Z)-2-(5-phenyltetrazol-1-yl)-3-thiophen-2-ylprop-2-enoate (PubChem CID 7810240) has the molecular formula C20H20N4O3S and a molecular weight of 396.47 g/mol. Its IUPAC name is (3,3-dimethyl-2-oxobutyl) (Z)-2-(5-phenyltetrazol-1-yl)-3-thiophen-2-ylprop-2-enoate.
| Compound Name | (3,3-dimethyl-2-oxobutyl) (Z)-2-(5-phenyltetrazol-1-yl)-3-thiophen-2-ylprop-2-enoate |
|---|---|
| PubChem CID | 7810240 |
| Molecular Formula | C20H20N4O3S |
| Molecular Weight | 396.47 g/mol |
| Exact Mass | 396.13 |
| IUPAC Name | (3,3-dimethyl-2-oxobutyl) (Z)-2-(5-phenyltetrazol-1-yl)-3-thiophen-2-ylprop-2-enoate |
| SMILES | CC(C)(C)C(=O)COC(=O)/C(=C/c1cccs1)n1nnnc1-c1ccccc1 |
| InChI | InChI=1S/C20H20N4O3S/c1-20(2,3)17(25)13-27-19(26)16(12-15-10-7-11-28-15)24-18(21-22-23-24)14-8-5-4-6-9-14/h4-12H,13H2,1-3H3/b16-12- |
| InChIKey | XTLMFVJLQNGVBY-VBKFSLOCSA-N |
| XLogP | 3.56 |
| TPSA | 86.97 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 396.47 |
| LogP ≤ 5 | 3.56 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|