C26H20FN7O2 — CID 167807303
(4,5-diphenyl-1,2,4-triazol-3-yl)methyl (Z)-3-(3-fluorophenyl)-2-(5-methyltetrazol-1-yl)prop-2-enoate (PubChem CID 167807303) has the molecular formula C26H20FN7O2 and a molecular weight of 481.49 g/mol. Its IUPAC name is (4,5-diphenyl-1,2,4-triazol-3-yl)methyl (Z)-3-(3-fluorophenyl)-2-(5-methyltetrazol-1-yl)prop-2-enoate.
| Compound Name | (4,5-diphenyl-1,2,4-triazol-3-yl)methyl (Z)-3-(3-fluorophenyl)-2-(5-methyltetrazol-1-yl)prop-2-enoate |
|---|---|
| PubChem CID | 167807303 |
| Molecular Formula | C26H20FN7O2 |
| Molecular Weight | 481.49 g/mol |
| Exact Mass | 481.17 |
| IUPAC Name | (4,5-diphenyl-1,2,4-triazol-3-yl)methyl (Z)-3-(3-fluorophenyl)-2-(5-methyltetrazol-1-yl)prop-2-enoate |
| SMILES | Cc1nnnn1/C(=C\c1cccc(F)c1)C(=O)OCc1nnc(-c2ccccc2)n1-c1ccccc1 |
| InChI | InChI=1S/C26H20FN7O2/c1-18-28-31-32-34(18)23(16-19-9-8-12-21(27)15-19)26(35)36-17-24-29-30-25(20-10-4-2-5-11-20)33(24)22-13-6-3-7-14-22/h2-16H,17H2,1H3/b23-16- |
| InChIKey | NXZXXRFUCFRQIP-KQWNVCNZSA-N |
| XLogP | 4.11 |
| TPSA | 100.61 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 36 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 481.49 |
| LogP ≤ 5 | 4.11 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|