C21H16FN5O2S — CID 31222687
(2-phenyl-1,3-thiazol-4-yl)methyl (Z)-3-(3-fluorophenyl)-2-(5-methyltetrazol-1-yl)prop-2-enoate (PubChem CID 31222687) has the molecular formula C21H16FN5O2S and a molecular weight of 421.46 g/mol. Its IUPAC name is (2-phenyl-1,3-thiazol-4-yl)methyl (Z)-3-(3-fluorophenyl)-2-(5-methyltetrazol-1-yl)prop-2-enoate.
| Compound Name | (2-phenyl-1,3-thiazol-4-yl)methyl (Z)-3-(3-fluorophenyl)-2-(5-methyltetrazol-1-yl)prop-2-enoate |
|---|---|
| PubChem CID | 31222687 |
| Molecular Formula | C21H16FN5O2S |
| Molecular Weight | 421.46 g/mol |
| Exact Mass | 421.10 |
| IUPAC Name | (2-phenyl-1,3-thiazol-4-yl)methyl (Z)-3-(3-fluorophenyl)-2-(5-methyltetrazol-1-yl)prop-2-enoate |
| SMILES | Cc1nnnn1/C(=C\c1cccc(F)c1)C(=O)OCc1csc(-c2ccccc2)n1 |
| InChI | InChI=1S/C21H16FN5O2S/c1-14-24-25-26-27(14)19(11-15-6-5-9-17(22)10-15)21(28)29-12-18-13-30-20(23-18)16-7-3-2-4-8-16/h2-11,13H,12H2,1H3/b19-11- |
| InChIKey | SBHDDLRIVRRFMX-ODLFYWEKSA-N |
| XLogP | 3.99 |
| TPSA | 82.79 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 421.46 |
| LogP ≤ 5 | 3.99 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|