C26H21N5O3 — CID 155947022
phenanthridin-6-ylmethyl (E)-3-(3-methoxyphenyl)-2-(5-methyltetrazol-1-yl)prop-2-enoate (PubChem CID 155947022) has the molecular formula C26H21N5O3 and a molecular weight of 451.49 g/mol. Its IUPAC name is phenanthridin-6-ylmethyl (E)-3-(3-methoxyphenyl)-2-(5-methyltetrazol-1-yl)prop-2-enoate.
| Compound Name | phenanthridin-6-ylmethyl (E)-3-(3-methoxyphenyl)-2-(5-methyltetrazol-1-yl)prop-2-enoate |
|---|---|
| PubChem CID | 155947022 |
| Molecular Formula | C26H21N5O3 |
| Molecular Weight | 451.49 g/mol |
| Exact Mass | 451.16 |
| IUPAC Name | phenanthridin-6-ylmethyl (E)-3-(3-methoxyphenyl)-2-(5-methyltetrazol-1-yl)prop-2-enoate |
| SMILES | COc1cccc(/C=C(\C(=O)OCc2nc3ccccc3c3ccccc23)n2nnnc2C)c1 |
| InChI | InChI=1S/C26H21N5O3/c1-17-28-29-30-31(17)25(15-18-8-7-9-19(14-18)33-2)26(32)34-16-24-22-12-4-3-10-20(22)21-11-5-6-13-23(21)27-24/h3-15H,16H2,1-2H3/b25-15+ |
| InChIKey | UFYAAUVKSPRSHI-MFKUBSTISA-N |
| XLogP | 4.43 |
| TPSA | 92.02 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 451.49 |
| LogP ≤ 5 | 4.43 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'} |
|---|