C16H20N6O2 — CID 167941423
(Z)-1-[(3R)-3-aminopyrrolidin-1-yl]-3-(3-methoxyphenyl)-2-(5-methyltetrazol-1-yl)prop-2-en-1-one (PubChem CID 167941423) has the molecular formula C16H20N6O2 and a molecular weight of 328.38 g/mol. Its IUPAC name is (Z)-1-[(3R)-3-aminopyrrolidin-1-yl]-3-(3-methoxyphenyl)-2-(5-methyltetrazol-1-yl)prop-2-en-1-one.
| Compound Name | (Z)-1-[(3R)-3-aminopyrrolidin-1-yl]-3-(3-methoxyphenyl)-2-(5-methyltetrazol-1-yl)prop-2-en-1-one |
|---|---|
| PubChem CID | 167941423 |
| Molecular Formula | C16H20N6O2 |
| Molecular Weight | 328.38 g/mol |
| Exact Mass | 328.16 |
| IUPAC Name | (Z)-1-[(3R)-3-aminopyrrolidin-1-yl]-3-(3-methoxyphenyl)-2-(5-methyltetrazol-1-yl)prop-2-en-1-one |
| SMILES | COc1cccc(/C=C(/C(=O)N2CC[C@@H](N)C2)n2nnnc2C)c1 |
| InChI | InChI=1S/C16H20N6O2/c1-11-18-19-20-22(11)15(16(23)21-7-6-13(17)10-21)9-12-4-3-5-14(8-12)24-2/h3-5,8-9,13H,6-7,10,17H2,1-2H3/b15-9-/t13-/m1/s1 |
| InChIKey | DJDWYAIMMUFDKJ-MLJKTZRHSA-N |
| XLogP | 0.55 |
| TPSA | 99.16 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 328.38 |
| LogP ≤ 5 | 0.55 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|