C20H18F3N5O3 — CID 78836954
(Z)-3-(3-methoxyphenyl)-2-(5-methyltetrazol-1-yl)-N-[[2-(trifluoromethoxy)phenyl]methyl]prop-2-enamide (PubChem CID 78836954) has the molecular formula C20H18F3N5O3 and a molecular weight of 433.39 g/mol. Its IUPAC name is (Z)-3-(3-methoxyphenyl)-2-(5-methyltetrazol-1-yl)-N-[[2-(trifluoromethoxy)phenyl]methyl]prop-2-enamide.
| Compound Name | (Z)-3-(3-methoxyphenyl)-2-(5-methyltetrazol-1-yl)-N-[[2-(trifluoromethoxy)phenyl]methyl]prop-2-enamide |
|---|---|
| PubChem CID | 78836954 |
| Molecular Formula | C20H18F3N5O3 |
| Molecular Weight | 433.39 g/mol |
| Exact Mass | 433.14 |
| IUPAC Name | (Z)-3-(3-methoxyphenyl)-2-(5-methyltetrazol-1-yl)-N-[[2-(trifluoromethoxy)phenyl]methyl]prop-2-enamide |
| SMILES | COc1cccc(/C=C(/C(=O)NCc2ccccc2OC(F)(F)F)n2nnnc2C)c1 |
| InChI | InChI=1S/C20H18F3N5O3/c1-13-25-26-27-28(13)17(11-14-6-5-8-16(10-14)30-2)19(29)24-12-15-7-3-4-9-18(15)31-20(21,22)23/h3-11H,12H2,1-2H3,(H,24,29)/b17-11- |
| InChIKey | MLJHSARKQVZLOX-BOPFTXTBSA-N |
| XLogP | 3.20 |
| TPSA | 91.16 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 433.39 |
| LogP ≤ 5 | 3.20 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|