C23H20N4O4 — CID 7908896
(7,8-dimethyl-2-oxochromen-4-yl)methyl (Z)-2-(5-methyltetrazol-1-yl)-3-phenylprop-2-enoate (PubChem CID 7908896) has the molecular formula C23H20N4O4 and a molecular weight of 416.44 g/mol. Its IUPAC name is (7,8-dimethyl-2-oxochromen-4-yl)methyl (Z)-2-(5-methyltetrazol-1-yl)-3-phenylprop-2-enoate.
| Compound Name | (7,8-dimethyl-2-oxochromen-4-yl)methyl (Z)-2-(5-methyltetrazol-1-yl)-3-phenylprop-2-enoate |
|---|---|
| PubChem CID | 7908896 |
| Molecular Formula | C23H20N4O4 |
| Molecular Weight | 416.44 g/mol |
| Exact Mass | 416.15 |
| IUPAC Name | (7,8-dimethyl-2-oxochromen-4-yl)methyl (Z)-2-(5-methyltetrazol-1-yl)-3-phenylprop-2-enoate |
| SMILES | Cc1ccc2c(COC(=O)/C(=C/c3ccccc3)n3nnnc3C)cc(=O)oc2c1C |
| InChI | InChI=1S/C23H20N4O4/c1-14-9-10-19-18(12-21(28)31-22(19)15(14)2)13-30-23(29)20(27-16(3)24-25-26-27)11-17-7-5-4-6-8-17/h4-12H,13H2,1-3H3/b20-11- |
| InChIKey | LMTFJJPQBSDUGD-JAIQZWGSSA-N |
| XLogP | 3.45 |
| TPSA | 100.11 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 416.44 |
| LogP ≤ 5 | 3.45 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'cumarine', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|