C23H19NO5 — CID 7537314
(7,8-dimethyl-2-oxochromen-4-yl)methyl (E)-2-cyano-3-(3-methoxyphenyl)prop-2-enoate (PubChem CID 7537314) has the molecular formula C23H19NO5 and a molecular weight of 389.41 g/mol. Its IUPAC name is (7,8-dimethyl-2-oxochromen-4-yl)methyl (E)-2-cyano-3-(3-methoxyphenyl)prop-2-enoate.
| Compound Name | (7,8-dimethyl-2-oxochromen-4-yl)methyl (E)-2-cyano-3-(3-methoxyphenyl)prop-2-enoate |
|---|---|
| PubChem CID | 7537314 |
| Molecular Formula | C23H19NO5 |
| Molecular Weight | 389.41 g/mol |
| Exact Mass | 389.13 |
| IUPAC Name | (7,8-dimethyl-2-oxochromen-4-yl)methyl (E)-2-cyano-3-(3-methoxyphenyl)prop-2-enoate |
| SMILES | COc1cccc(/C=C(\C#N)C(=O)OCc2cc(=O)oc3c(C)c(C)ccc23)c1 |
| InChI | InChI=1S/C23H19NO5/c1-14-7-8-20-18(11-21(25)29-22(20)15(14)2)13-28-23(26)17(12-24)9-16-5-4-6-19(10-16)27-3/h4-11H,13H2,1-3H3/b17-9+ |
| InChIKey | HXCQYKGWVZQYOE-RQZCQDPDSA-N |
| XLogP | 4.07 |
| TPSA | 89.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 389.41 |
| LogP ≤ 5 | 4.07 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'cumarine', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|