C14H14N4O2 — CID 75482323
7,8-dimethyl-4-[(5-methyltetrazol-1-yl)methyl]chromen-2-one (PubChem CID 75482323) has the molecular formula C14H14N4O2 and a molecular weight of 270.29 g/mol. Its IUPAC name is 7,8-dimethyl-4-[(5-methyltetrazol-1-yl)methyl]chromen-2-one.
| Compound Name | 7,8-dimethyl-4-[(5-methyltetrazol-1-yl)methyl]chromen-2-one |
|---|---|
| PubChem CID | 75482323 |
| Molecular Formula | C14H14N4O2 |
| Molecular Weight | 270.29 g/mol |
| Exact Mass | 270.11 |
| IUPAC Name | 7,8-dimethyl-4-[(5-methyltetrazol-1-yl)methyl]chromen-2-one |
| SMILES | Cc1ccc2c(Cn3nnnc3C)cc(=O)oc2c1C |
| InChI | InChI=1S/C14H14N4O2/c1-8-4-5-12-11(7-18-10(3)15-16-17-18)6-13(19)20-14(12)9(8)2/h4-6H,7H2,1-3H3 |
| InChIKey | OKKRTTHQRIHINM-UHFFFAOYSA-N |
| XLogP | 1.75 |
| TPSA | 73.81 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 270.29 |
| LogP ≤ 5 | 1.75 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'cumarine', 'substructure': 'N/A'} |
|---|