C15H15N3O3 — CID 100689569
2-[(7,8-dimethyl-2-oxochromen-4-yl)methyl]-1-methyl-1,2,4-triazol-3-one (PubChem CID 100689569) has the molecular formula C15H15N3O3 and a molecular weight of 285.30 g/mol. Its IUPAC name is 2-[(7,8-dimethyl-2-oxochromen-4-yl)methyl]-1-methyl-1,2,4-triazol-3-one.
| Compound Name | 2-[(7,8-dimethyl-2-oxochromen-4-yl)methyl]-1-methyl-1,2,4-triazol-3-one |
|---|---|
| PubChem CID | 100689569 |
| Molecular Formula | C15H15N3O3 |
| Molecular Weight | 285.30 g/mol |
| Exact Mass | 285.11 |
| IUPAC Name | 2-[(7,8-dimethyl-2-oxochromen-4-yl)methyl]-1-methyl-1,2,4-triazol-3-one |
| SMILES | Cc1ccc2c(Cn3c(=O)ncn3C)cc(=O)oc2c1C |
| InChI | InChI=1S/C15H15N3O3/c1-9-4-5-12-11(6-13(19)21-14(12)10(9)2)7-18-15(20)16-8-17(18)3/h4-6,8H,7H2,1-3H3 |
| InChIKey | GORLNVGKKTUTMI-UHFFFAOYSA-N |
| XLogP | 1.35 |
| TPSA | 70.03 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 285.30 |
| LogP ≤ 5 | 1.35 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'cumarine', 'substructure': 'N/A'} |
|---|