C23H22N2O3S — CID 112772888
4-[(7,8-dimethyl-2-oxochromen-4-yl)methyl]-8-thia-4,6-diazatricyclo[7.5.0.02,7]tetradeca-1(9),2(7),5-trien-3-one (PubChem CID 112772888) has the molecular formula C23H22N2O3S and a molecular weight of 406.51 g/mol. Its IUPAC name is 4-[(7,8-dimethyl-2-oxochromen-4-yl)methyl]-8-thia-4,6-diazatricyclo[7.5.0.02,7]tetradeca-1(9),2(7),5-trien-3-one.
| Compound Name | 4-[(7,8-dimethyl-2-oxochromen-4-yl)methyl]-8-thia-4,6-diazatricyclo[7.5.0.02,7]tetradeca-1(9),2(7),5-trien-3-one |
|---|---|
| PubChem CID | 112772888 |
| Molecular Formula | C23H22N2O3S |
| Molecular Weight | 406.51 g/mol |
| Exact Mass | 406.14 |
| IUPAC Name | 4-[(7,8-dimethyl-2-oxochromen-4-yl)methyl]-8-thia-4,6-diazatricyclo[7.5.0.02,7]tetradeca-1(9),2(7),5-trien-3-one |
| SMILES | Cc1ccc2c(Cn3cnc4sc5c(c4c3=O)CCCCC5)cc(=O)oc2c1C |
| InChI | InChI=1S/C23H22N2O3S/c1-13-8-9-16-15(10-19(26)28-21(16)14(13)2)11-25-12-24-22-20(23(25)27)17-6-4-3-5-7-18(17)29-22/h8-10,12H,3-7,11H2,1-2H3 |
| InChIKey | CUHXWMLCLHUNGC-UHFFFAOYSA-N |
| XLogP | 4.50 |
| TPSA | 65.10 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 406.51 |
| LogP ≤ 5 | 4.50 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'het_65_pyridone_A(3)', 'substructure': 'N/A'}, {'alert_name': 'cumarine', 'substructure': 'N/A'} |
|---|