C15H16N4O2S — CID 75402578
4-[(3-methyl-1,2,4-oxadiazol-5-yl)methyl]-8-thia-4,6-diazatricyclo[7.5.0.02,7]tetradeca-1(9),2(7),5-trien-3-one (PubChem CID 75402578) has the molecular formula C15H16N4O2S and a molecular weight of 316.39 g/mol. Its IUPAC name is 4-[(3-methyl-1,2,4-oxadiazol-5-yl)methyl]-8-thia-4,6-diazatricyclo[7.5.0.02,7]tetradeca-1(9),2(7),5-trien-3-one.
| Compound Name | 4-[(3-methyl-1,2,4-oxadiazol-5-yl)methyl]-8-thia-4,6-diazatricyclo[7.5.0.02,7]tetradeca-1(9),2(7),5-trien-3-one |
|---|---|
| PubChem CID | 75402578 |
| Molecular Formula | C15H16N4O2S |
| Molecular Weight | 316.39 g/mol |
| Exact Mass | 316.10 |
| IUPAC Name | 4-[(3-methyl-1,2,4-oxadiazol-5-yl)methyl]-8-thia-4,6-diazatricyclo[7.5.0.02,7]tetradeca-1(9),2(7),5-trien-3-one |
| SMILES | Cc1noc(Cn2cnc3sc4c(c3c2=O)CCCCC4)n1 |
| InChI | InChI=1S/C15H16N4O2S/c1-9-17-12(21-18-9)7-19-8-16-14-13(15(19)20)10-5-3-2-4-6-11(10)22-14/h8H,2-7H2,1H3 |
| InChIKey | MZHBUCZGXQNTLZ-UHFFFAOYSA-N |
| XLogP | 2.47 |
| TPSA | 73.81 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 316.39 |
| LogP ≤ 5 | 2.47 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |