C18H24ClN5O2S — CID 120869269
3-[2-[3-[2-(methylamino)propyl]-1,2,4-oxadiazol-5-yl]ethyl]-5,6,7,8-tetrahydro-[1]benzothiolo[2,3-d]pyrimidin-4-one;hydrochloride (PubChem CID 120869269) has the molecular formula C18H24ClN5O2S and a molecular weight of 409.94 g/mol. Its IUPAC name is 3-[2-[3-[2-(methylamino)propyl]-1,2,4-oxadiazol-5-yl]ethyl]-5,6,7,8-tetrahydro-[1]benzothiolo[2,3-d]pyrimidin-4-one;hydrochloride.
| Compound Name | 3-[2-[3-[2-(methylamino)propyl]-1,2,4-oxadiazol-5-yl]ethyl]-5,6,7,8-tetrahydro-[1]benzothiolo[2,3-d]pyrimidin-4-one;hydrochloride |
|---|---|
| PubChem CID | 120869269 |
| Molecular Formula | C18H24ClN5O2S |
| Molecular Weight | 409.94 g/mol |
| Exact Mass | 409.13 |
| IUPAC Name | 3-[2-[3-[2-(methylamino)propyl]-1,2,4-oxadiazol-5-yl]ethyl]-5,6,7,8-tetrahydro-[1]benzothiolo[2,3-d]pyrimidin-4-one;hydrochloride |
| SMILES | CNC(C)Cc1noc(CCn2cnc3sc4c(c3c2=O)CCCC4)n1.Cl |
| InChI | InChI=1S/C18H23N5O2S.ClH/c1-11(19-2)9-14-21-15(25-22-14)7-8-23-10-20-17-16(18(23)24)12-5-3-4-6-13(12)26-17;/h10-11,19H,3-9H2,1-2H3;1H |
| InChIKey | RHBVPWHIESHVIR-UHFFFAOYSA-N |
| XLogP | 2.53 |
| TPSA | 85.84 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 409.94 |
| LogP ≤ 5 | 2.53 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |