C20H25N3O2 — CID 9265888
4-[[3-(3,5-dimethylpyrazol-1-yl)propylamino]methyl]-7,8-dimethylchromen-2-one (PubChem CID 9265888) has the molecular formula C20H25N3O2 and a molecular weight of 339.44 g/mol. Its IUPAC name is 4-[[3-(3,5-dimethylpyrazol-1-yl)propylamino]methyl]-7,8-dimethylchromen-2-one.
| Compound Name | 4-[[3-(3,5-dimethylpyrazol-1-yl)propylamino]methyl]-7,8-dimethylchromen-2-one |
|---|---|
| PubChem CID | 9265888 |
| Molecular Formula | C20H25N3O2 |
| Molecular Weight | 339.44 g/mol |
| Exact Mass | 339.19 |
| IUPAC Name | 4-[[3-(3,5-dimethylpyrazol-1-yl)propylamino]methyl]-7,8-dimethylchromen-2-one |
| SMILES | Cc1cc(C)n(CCCNCc2cc(=O)oc3c(C)c(C)ccc23)n1 |
| InChI | InChI=1S/C20H25N3O2/c1-13-6-7-18-17(11-19(24)25-20(18)16(13)4)12-21-8-5-9-23-15(3)10-14(2)22-23/h6-7,10-11,21H,5,8-9,12H2,1-4H3 |
| InChIKey | NUAUERTTZBUQBL-UHFFFAOYSA-N |
| XLogP | 3.40 |
| TPSA | 60.06 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 339.44 |
| LogP ≤ 5 | 3.40 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'cumarine', 'substructure': 'N/A'} |
|---|