C29H30N2O2 — CID 2450878
4-[(4-benzhydrylpiperazin-1-yl)methyl]-7,8-dimethylchromen-2-one (PubChem CID 2450878) has the molecular formula C29H30N2O2 and a molecular weight of 438.57 g/mol. Its IUPAC name is 4-[(4-benzhydrylpiperazin-1-yl)methyl]-7,8-dimethylchromen-2-one.
| Compound Name | 4-[(4-benzhydrylpiperazin-1-yl)methyl]-7,8-dimethylchromen-2-one |
|---|---|
| PubChem CID | 2450878 |
| Molecular Formula | C29H30N2O2 |
| Molecular Weight | 438.57 g/mol |
| Exact Mass | 438.23 |
| IUPAC Name | 4-[(4-benzhydrylpiperazin-1-yl)methyl]-7,8-dimethylchromen-2-one |
| SMILES | Cc1ccc2c(CN3CCN(C(c4ccccc4)c4ccccc4)CC3)cc(=O)oc2c1C |
| InChI | InChI=1S/C29H30N2O2/c1-21-13-14-26-25(19-27(32)33-29(26)22(21)2)20-30-15-17-31(18-16-30)28(23-9-5-3-6-10-23)24-11-7-4-8-12-24/h3-14,19,28H,15-18,20H2,1-2H3 |
| InChIKey | SEIGUHUSQBICMN-UHFFFAOYSA-N |
| XLogP | 5.32 |
| TPSA | 36.69 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 438.57 |
| LogP ≤ 5 | 5.32 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'cumarine', 'substructure': 'N/A'} |
|---|