C23H22N4O4 — CID 55412343
propan-2-yl 3-[2-[(7,8-dimethyl-2-oxochromen-4-yl)methyl]tetrazol-5-yl]benzoate (PubChem CID 55412343) has the molecular formula C23H22N4O4 and a molecular weight of 418.45 g/mol. Its IUPAC name is propan-2-yl 3-[2-[(7,8-dimethyl-2-oxochromen-4-yl)methyl]tetrazol-5-yl]benzoate.
| Compound Name | propan-2-yl 3-[2-[(7,8-dimethyl-2-oxochromen-4-yl)methyl]tetrazol-5-yl]benzoate |
|---|---|
| PubChem CID | 55412343 |
| Molecular Formula | C23H22N4O4 |
| Molecular Weight | 418.45 g/mol |
| Exact Mass | 418.16 |
| IUPAC Name | propan-2-yl 3-[2-[(7,8-dimethyl-2-oxochromen-4-yl)methyl]tetrazol-5-yl]benzoate |
| SMILES | Cc1ccc2c(Cn3nnc(-c4cccc(C(=O)OC(C)C)c4)n3)cc(=O)oc2c1C |
| InChI | InChI=1S/C23H22N4O4/c1-13(2)30-23(29)17-7-5-6-16(10-17)22-24-26-27(25-22)12-18-11-20(28)31-21-15(4)14(3)8-9-19(18)21/h5-11,13H,12H2,1-4H3 |
| InChIKey | HWCURSBHPLAZTO-UHFFFAOYSA-N |
| XLogP | 3.68 |
| TPSA | 100.11 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 418.45 |
| LogP ≤ 5 | 3.68 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'cumarine', 'substructure': 'N/A'} |
|---|