C19H21N5O4 — CID 55424266
propan-2-yl 3-[2-[2-[furan-2-ylmethyl(methyl)amino]-2-oxoethyl]tetrazol-5-yl]benzoate (PubChem CID 55424266) has the molecular formula C19H21N5O4 and a molecular weight of 383.41 g/mol. Its IUPAC name is propan-2-yl 3-[2-[2-[furan-2-ylmethyl(methyl)amino]-2-oxoethyl]tetrazol-5-yl]benzoate.
| Compound Name | propan-2-yl 3-[2-[2-[furan-2-ylmethyl(methyl)amino]-2-oxoethyl]tetrazol-5-yl]benzoate |
|---|---|
| PubChem CID | 55424266 |
| Molecular Formula | C19H21N5O4 |
| Molecular Weight | 383.41 g/mol |
| Exact Mass | 383.16 |
| IUPAC Name | propan-2-yl 3-[2-[2-[furan-2-ylmethyl(methyl)amino]-2-oxoethyl]tetrazol-5-yl]benzoate |
| SMILES | CC(C)OC(=O)c1cccc(-c2nnn(CC(=O)N(C)Cc3ccco3)n2)c1 |
| InChI | InChI=1S/C19H21N5O4/c1-13(2)28-19(26)15-7-4-6-14(10-15)18-20-22-24(21-18)12-17(25)23(3)11-16-8-5-9-27-16/h4-10,13H,11-12H2,1-3H3 |
| InChIKey | JDOFXLCQLDKBDV-UHFFFAOYSA-N |
| XLogP | 2.16 |
| TPSA | 103.35 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 383.41 |
| LogP ≤ 5 | 2.16 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |