C21H19N5O2 — CID 134011749
N-(furan-2-ylmethyl)-N-(4-methylphenyl)-2-(5-phenyltetrazol-2-yl)acetamide (PubChem CID 134011749) has the molecular formula C21H19N5O2 and a molecular weight of 373.42 g/mol. Its IUPAC name is N-(furan-2-ylmethyl)-N-(4-methylphenyl)-2-(5-phenyltetrazol-2-yl)acetamide.
| Compound Name | N-(furan-2-ylmethyl)-N-(4-methylphenyl)-2-(5-phenyltetrazol-2-yl)acetamide |
|---|---|
| PubChem CID | 134011749 |
| Molecular Formula | C21H19N5O2 |
| Molecular Weight | 373.42 g/mol |
| Exact Mass | 373.15 |
| IUPAC Name | N-(furan-2-ylmethyl)-N-(4-methylphenyl)-2-(5-phenyltetrazol-2-yl)acetamide |
| SMILES | Cc1ccc(N(Cc2ccco2)C(=O)Cn2nnc(-c3ccccc3)n2)cc1 |
| InChI | InChI=1S/C21H19N5O2/c1-16-9-11-18(12-10-16)25(14-19-8-5-13-28-19)20(27)15-26-23-21(22-24-26)17-6-3-2-4-7-17/h2-13H,14-15H2,1H3 |
| InChIKey | KZYCJWJHASRXRY-UHFFFAOYSA-N |
| XLogP | 3.47 |
| TPSA | 77.05 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 373.42 |
| LogP ≤ 5 | 3.47 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |