C20H18N4O2 — CID 51189023
2-(benzotriazol-1-yl)-N-(furan-2-ylmethyl)-N-(4-methylphenyl)acetamide (PubChem CID 51189023) has the molecular formula C20H18N4O2 and a molecular weight of 346.39 g/mol. Its IUPAC name is 2-(benzotriazol-1-yl)-N-(furan-2-ylmethyl)-N-(4-methylphenyl)acetamide.
| Compound Name | 2-(benzotriazol-1-yl)-N-(furan-2-ylmethyl)-N-(4-methylphenyl)acetamide |
|---|---|
| PubChem CID | 51189023 |
| Molecular Formula | C20H18N4O2 |
| Molecular Weight | 346.39 g/mol |
| Exact Mass | 346.14 |
| IUPAC Name | 2-(benzotriazol-1-yl)-N-(furan-2-ylmethyl)-N-(4-methylphenyl)acetamide |
| SMILES | Cc1ccc(N(Cc2ccco2)C(=O)Cn2nnc3ccccc32)cc1 |
| InChI | InChI=1S/C20H18N4O2/c1-15-8-10-16(11-9-15)23(13-17-5-4-12-26-17)20(25)14-24-19-7-3-2-6-18(19)21-22-24/h2-12H,13-14H2,1H3 |
| InChIKey | NKIJIAKANSDIDS-UHFFFAOYSA-N |
| XLogP | 3.57 |
| TPSA | 64.16 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 346.39 |
| LogP ≤ 5 | 3.57 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |