C16H19NO2 — CID 60528113
N-(furan-2-ylmethyl)-N-(4-methylphenyl)butanamide (PubChem CID 60528113) has the molecular formula C16H19NO2 and a molecular weight of 257.33 g/mol. Its IUPAC name is N-(furan-2-ylmethyl)-N-(4-methylphenyl)butanamide.
| Compound Name | N-(furan-2-ylmethyl)-N-(4-methylphenyl)butanamide |
|---|---|
| PubChem CID | 60528113 |
| Molecular Formula | C16H19NO2 |
| Molecular Weight | 257.33 g/mol |
| Exact Mass | 257.14 |
| IUPAC Name | N-(furan-2-ylmethyl)-N-(4-methylphenyl)butanamide |
| SMILES | CCCC(=O)N(Cc1ccco1)c1ccc(C)cc1 |
| InChI | InChI=1S/C16H19NO2/c1-3-5-16(18)17(12-15-6-4-11-19-15)14-9-7-13(2)8-10-14/h4,6-11H,3,5,12H2,1-2H3 |
| InChIKey | WJOXKKDRFDSOQI-UHFFFAOYSA-N |
| XLogP | 3.92 |
| TPSA | 33.45 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 257.33 |
| LogP ≤ 5 | 3.92 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |