C18H24N6O4 — CID 55412602
propan-2-yl 3-[2-[2-(butylcarbamoylamino)-2-oxoethyl]tetrazol-5-yl]benzoate (PubChem CID 55412602) has the molecular formula C18H24N6O4 and a molecular weight of 388.43 g/mol. Its IUPAC name is propan-2-yl 3-[2-[2-(butylcarbamoylamino)-2-oxoethyl]tetrazol-5-yl]benzoate.
| Compound Name | propan-2-yl 3-[2-[2-(butylcarbamoylamino)-2-oxoethyl]tetrazol-5-yl]benzoate |
|---|---|
| PubChem CID | 55412602 |
| Molecular Formula | C18H24N6O4 |
| Molecular Weight | 388.43 g/mol |
| Exact Mass | 388.19 |
| IUPAC Name | propan-2-yl 3-[2-[2-(butylcarbamoylamino)-2-oxoethyl]tetrazol-5-yl]benzoate |
| SMILES | CCCCNC(=O)NC(=O)Cn1nnc(-c2cccc(C(=O)OC(C)C)c2)n1 |
| InChI | InChI=1S/C18H24N6O4/c1-4-5-9-19-18(27)20-15(25)11-24-22-16(21-23-24)13-7-6-8-14(10-13)17(26)28-12(2)3/h6-8,10,12H,4-5,9,11H2,1-3H3,(H2,19,20,25,27) |
| InChIKey | RWSNOZJCDIUQHH-UHFFFAOYSA-N |
| XLogP | 1.53 |
| TPSA | 128.10 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 388.43 |
| LogP ≤ 5 | 1.53 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|