C15H12Cl3FO — CID 174712029
2-chloro-2-(6-chloro-1-fluoro-6-methyl-3-phenylcyclohexa-2,4-dien-1-yl)acetyl chloride (PubChem CID 174712029) has the molecular formula C15H12Cl3FO and a molecular weight of 333.62 g/mol. Its IUPAC name is 2-chloro-2-(6-chloro-1-fluoro-6-methyl-3-phenylcyclohexa-2,4-dien-1-yl)acetyl chloride.
| Compound Name | 2-chloro-2-(6-chloro-1-fluoro-6-methyl-3-phenylcyclohexa-2,4-dien-1-yl)acetyl chloride |
|---|---|
| PubChem CID | 174712029 |
| Molecular Formula | C15H12Cl3FO |
| Molecular Weight | 333.62 g/mol |
| Exact Mass | 331.99 |
| IUPAC Name | 2-chloro-2-(6-chloro-1-fluoro-6-methyl-3-phenylcyclohexa-2,4-dien-1-yl)acetyl chloride |
| SMILES | CC1(Cl)C=CC(c2ccccc2)=CC1(F)C(Cl)C(=O)Cl |
| InChI | InChI=1S/C15H12Cl3FO/c1-14(18)8-7-11(10-5-3-2-4-6-10)9-15(14,19)12(16)13(17)20/h2-9,12H,1H3 |
| InChIKey | LGXWOAVPPNYJPN-UHFFFAOYSA-N |
| XLogP | 4.72 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 333.62 |
| LogP ≤ 5 | 4.72 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'acid_halide', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|