C15H14Cl2 — CID 174373438
6,6-dichloro-2-phenyl-5-propan-2-ylidenecyclohexa-1,3-diene (PubChem CID 174373438) has the molecular formula C15H14Cl2 and a molecular weight of 265.18 g/mol. Its IUPAC name is 6,6-dichloro-2-phenyl-5-propan-2-ylidenecyclohexa-1,3-diene.
| Compound Name | 6,6-dichloro-2-phenyl-5-propan-2-ylidenecyclohexa-1,3-diene |
|---|---|
| PubChem CID | 174373438 |
| Molecular Formula | C15H14Cl2 |
| Molecular Weight | 265.18 g/mol |
| Exact Mass | 264.05 |
| IUPAC Name | 6,6-dichloro-2-phenyl-5-propan-2-ylidenecyclohexa-1,3-diene |
| SMILES | CC(C)=C1C=CC(c2ccccc2)=CC1(Cl)Cl |
| InChI | InChI=1S/C15H14Cl2/c1-11(2)14-9-8-13(10-15(14,16)17)12-6-4-3-5-7-12/h3-10H,1-2H3 |
| InChIKey | DNOMVCXUGAANTH-UHFFFAOYSA-N |
| XLogP | 5.15 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 1 |
| Heavy Atoms | 17 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 265.18 |
| LogP ≤ 5 | 5.15 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|