C12H12N4O4 — CID 22989068
6,6-dinitro-4-phenylcyclohexa-2,4-diene-1,1-diamine (PubChem CID 22989068) has the molecular formula C12H12N4O4 and a molecular weight of 276.25 g/mol. Its IUPAC name is 6,6-dinitro-4-phenylcyclohexa-2,4-diene-1,1-diamine.
| Compound Name | 6,6-dinitro-4-phenylcyclohexa-2,4-diene-1,1-diamine |
|---|---|
| PubChem CID | 22989068 |
| Molecular Formula | C12H12N4O4 |
| Molecular Weight | 276.25 g/mol |
| Exact Mass | 276.09 |
| IUPAC Name | 6,6-dinitro-4-phenylcyclohexa-2,4-diene-1,1-diamine |
| SMILES | NC1(N)C=CC(c2ccccc2)=CC1([N+](=O)[O-])[N+](=O)[O-] |
| InChI | InChI=1S/C12H12N4O4/c13-11(14)7-6-10(9-4-2-1-3-5-9)8-12(11,15(17)18)16(19)20/h1-8H,13-14H2 |
| InChIKey | WHHLVKMWXMPZGG-UHFFFAOYSA-N |
| XLogP | 0.50 |
| TPSA | 138.32 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 276.25 |
| LogP ≤ 5 | 0.50 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|