C19H16IN3O3 — CID 142716771
1-(4-iodophenyl)-3-(1-nitro-4-phenylcyclohexa-2,4-dien-1-yl)urea (PubChem CID 142716771) has the molecular formula C19H16IN3O3 and a molecular weight of 461.26 g/mol. Its IUPAC name is 1-(4-iodophenyl)-3-(1-nitro-4-phenylcyclohexa-2,4-dien-1-yl)urea.
| Compound Name | 1-(4-iodophenyl)-3-(1-nitro-4-phenylcyclohexa-2,4-dien-1-yl)urea |
|---|---|
| PubChem CID | 142716771 |
| Molecular Formula | C19H16IN3O3 |
| Molecular Weight | 461.26 g/mol |
| Exact Mass | 461.02 |
| IUPAC Name | 1-(4-iodophenyl)-3-(1-nitro-4-phenylcyclohexa-2,4-dien-1-yl)urea |
| SMILES | O=C(Nc1ccc(I)cc1)NC1([N+](=O)[O-])C=CC(c2ccccc2)=CC1 |
| InChI | InChI=1S/C19H16IN3O3/c20-16-6-8-17(9-7-16)21-18(24)22-19(23(25)26)12-10-15(11-13-19)14-4-2-1-3-5-14/h1-12H,13H2,(H2,21,22,24) |
| InChIKey | UFZWVJSDDUAAQJ-UHFFFAOYSA-N |
| XLogP | 4.43 |
| TPSA | 84.27 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 461.26 |
| LogP ≤ 5 | 4.43 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|