C18H28O6Si2 — CID 137350344
trimethoxy-(4-phenyl-1-trimethoxysilylcyclohexa-2,4-dien-1-yl)silane (PubChem CID 137350344) has the molecular formula C18H28O6Si2 and a molecular weight of 396.59 g/mol. Its IUPAC name is trimethoxy-(4-phenyl-1-trimethoxysilylcyclohexa-2,4-dien-1-yl)silane.
| Compound Name | trimethoxy-(4-phenyl-1-trimethoxysilylcyclohexa-2,4-dien-1-yl)silane |
|---|---|
| PubChem CID | 137350344 |
| Molecular Formula | C18H28O6Si2 |
| Molecular Weight | 396.59 g/mol |
| Exact Mass | 396.14 |
| IUPAC Name | trimethoxy-(4-phenyl-1-trimethoxysilylcyclohexa-2,4-dien-1-yl)silane |
| SMILES | CO[Si](OC)(OC)C1([Si](OC)(OC)OC)C=CC(c2ccccc2)=CC1 |
| InChI | InChI=1S/C18H28O6Si2/c1-19-25(20-2,21-3)18(26(22-4,23-5)24-6)14-12-17(13-15-18)16-10-8-7-9-11-16/h7-14H,15H2,1-6H3 |
| InChIKey | BAOLJWAAUVDPBY-UHFFFAOYSA-N |
| XLogP | 3.07 |
| TPSA | 55.38 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 396.59 |
| LogP ≤ 5 | 3.07 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|