C12H10Na2O6S2 — CID 87814814
disodium;4-phenylcyclohexa-2,4-diene-1,1-disulfonate (PubChem CID 87814814) has the molecular formula C12H10Na2O6S2 and a molecular weight of 360.32 g/mol. Its IUPAC name is disodium;4-phenylcyclohexa-2,4-diene-1,1-disulfonate.
| Compound Name | disodium;4-phenylcyclohexa-2,4-diene-1,1-disulfonate |
|---|---|
| PubChem CID | 87814814 |
| Molecular Formula | C12H10Na2O6S2 |
| Molecular Weight | 360.32 g/mol |
| Exact Mass | 359.97 |
| IUPAC Name | disodium;4-phenylcyclohexa-2,4-diene-1,1-disulfonate |
| SMILES | O=S(=O)([O-])C1(S(=O)(=O)[O-])C=CC(c2ccccc2)=CC1.[Na+].[Na+] |
| InChI | InChI=1S/C12H12O6S2.2Na/c13-19(14,15)12(20(16,17)18)8-6-11(7-9-12)10-4-2-1-3-5-10;;/h1-8H,9H2,(H,13,14,15)(H,16,17,18);;/q;2*+1/p-2 |
| InChIKey | DTRXRUSTPUOMMC-UHFFFAOYSA-L |
| XLogP | -5.18 |
| TPSA | 114.40 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 360.32 |
| LogP ≤ 5 | -5.18 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|