C20H20N4O4 — CID 174440464
3,3-dimethyl-6,6-dinitro-4-(2-phenylphenyl)cyclohexa-1,4-diene-1,2-diamine (PubChem CID 174440464) has the molecular formula C20H20N4O4 and a molecular weight of 380.40 g/mol. Its IUPAC name is 3,3-dimethyl-6,6-dinitro-4-(2-phenylphenyl)cyclohexa-1,4-diene-1,2-diamine.
| Compound Name | 3,3-dimethyl-6,6-dinitro-4-(2-phenylphenyl)cyclohexa-1,4-diene-1,2-diamine |
|---|---|
| PubChem CID | 174440464 |
| Molecular Formula | C20H20N4O4 |
| Molecular Weight | 380.40 g/mol |
| Exact Mass | 380.15 |
| IUPAC Name | 3,3-dimethyl-6,6-dinitro-4-(2-phenylphenyl)cyclohexa-1,4-diene-1,2-diamine |
| SMILES | CC1(C)C(c2ccccc2-c2ccccc2)=CC([N+](=O)[O-])([N+](=O)[O-])C(N)=C1N |
| InChI | InChI=1S/C20H20N4O4/c1-19(2)16(12-20(23(25)26,24(27)28)18(22)17(19)21)15-11-7-6-10-14(15)13-8-4-3-5-9-13/h3-12H,21-22H2,1-2H3 |
| InChIKey | MYRIRGPZLWZIGP-UHFFFAOYSA-N |
| XLogP | 3.16 |
| TPSA | 138.32 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 380.40 |
| LogP ≤ 5 | 3.16 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|